Difference between revisions of "CPD-181"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite cis-21-CP-39-keto-40-Me-C60-ACPs == * common-name: ** a cis-keto-c60-meroacyl-[acp] == Reaction(s) known to consume the compound == == Re...") |
(Created page with "Category:metabolite == Metabolite 3-7-DIMETHYLXANTHINE == * common-name: ** theobromine * smiles: ** cn2(c=nc1(=c(c(nc(n(c)1)=o)=o)2)) * inchi-key: ** yapqbxqyljrxsa-uhfff...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 3-7-DIMETHYLXANTHINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** theobromine |
| + | * smiles: | ||
| + | ** cn2(c=nc1(=c(c(nc(n(c)1)=o)=o)2)) | ||
| + | * inchi-key: | ||
| + | ** yapqbxqyljrxsa-uhfffaoysa-n | ||
| + | * molecular-weight: | ||
| + | ** 180.166 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-11519]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=theobromine}} |
| + | {{#set: inchi-key=inchikey=yapqbxqyljrxsa-uhfffaoysa-n}} | ||
| + | {{#set: molecular-weight=180.166}} | ||
Revision as of 14:54, 5 January 2021
Contents
Metabolite 3-7-DIMETHYLXANTHINE
- common-name:
- theobromine
- smiles:
- cn2(c=nc1(=c(c(nc(n(c)1)=o)=o)2))
- inchi-key:
- yapqbxqyljrxsa-uhfffaoysa-n
- molecular-weight:
- 180.166
