Difference between revisions of "CPD-182"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Thiopurines == * common-name: ** a thiopurine == Reaction(s) known to consume the compound == * THIOPURINE-S-METHYLTRANSFERASE-RXN ==...") |
(Created page with "Category:metabolite == Metabolite CPD-14443 == * common-name: ** (2s,4s)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate * smiles: ** c1(c(o)cc(=nc1c([o-])=o)c([o-])=o) * inchi-k...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-14443 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (2s,4s)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate |
| + | * smiles: | ||
| + | ** c1(c(o)cc(=nc1c([o-])=o)c([o-])=o) | ||
| + | * inchi-key: | ||
| + | ** dvtpryhenfbcii-imjsidkusa-l | ||
| + | * molecular-weight: | ||
| + | ** 185.136 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-14014]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[DIHYDRODIPICSYN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(2s,4s)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate}} |
| + | {{#set: inchi-key=inchikey=dvtpryhenfbcii-imjsidkusa-l}} | ||
| + | {{#set: molecular-weight=185.136}} | ||
Revision as of 08:29, 15 March 2021
Contents
Metabolite CPD-14443
- common-name:
- (2s,4s)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate
- smiles:
- c1(c(o)cc(=nc1c([o-])=o)c([o-])=o)
- inchi-key:
- dvtpryhenfbcii-imjsidkusa-l
- molecular-weight:
- 185.136
