Difference between revisions of "CPD-182"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14443 == * common-name: ** (2s,4s)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate * smiles: ** c1(c(o)cc(=nc1c([o-])=o)c([o-])=o) * inchi-k...") |
(Created page with "Category:metabolite == Metabolite CPD-182 == * common-name: ** 4-methylumbelliferone * smiles: ** cc1(=cc(oc2(c=c(o)c=cc1=2))=o) * inchi-key: ** hshnitrmyyllcv-uhfffaoysa-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-182 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-methylumbelliferone |
* smiles: | * smiles: | ||
| − | ** | + | ** cc1(=cc(oc2(c=c(o)c=cc1=2))=o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** hshnitrmyyllcv-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 176.171 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[3.1.1.56-RXN]] |
| + | * [[RXN-10769]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-methylumbelliferone}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hshnitrmyyllcv-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=176.171}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-182
- common-name:
- 4-methylumbelliferone
- smiles:
- cc1(=cc(oc2(c=c(o)c=cc1=2))=o)
- inchi-key:
- hshnitrmyyllcv-uhfffaoysa-n
- molecular-weight:
- 176.171
