|
|
| (7 intermediate revisions by 3 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11245 RXN-11245] == | + | == Metabolite CPD-182 == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** 3-hydroxyacyl-coa dehydrogenase | + | ** 4-methylumbelliferone |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/1.1.1.35 ec-1.1.1.35] | + | ** cc1(=cc(oc2(c=c(o)c=cc1=2))=o) |
| − | == Reaction formula == | + | * inchi-key: |
| − | * 1 [[CPD-12199]][c] '''+''' 1 [[NAD]][c] '''=>''' 1 [[CPD-10600]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c]
| + | ** hshnitrmyyllcv-uhfffaoysa-n |
| − | == Gene(s) associated with this reaction == | + | * molecular-weight: |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | ** 176.171 |
| − | * Gene: [[SJ16470]]
| + | == Reaction(s) known to consume the compound == |
| − | ** Category: [[annotation]]
| + | == Reaction(s) known to produce the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a | + | * [[3.1.1.56-RXN]] |
| − | * Gene: [[SJ03584]]
| + | * [[RXN-10769]] |
| − | ** Category: [[annotation]] | + | == Reaction(s) of unknown directionality == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | {{#set: common-name=4-methylumbelliferone}} |
| − | * Gene: [[SJ06127]]
| + | {{#set: inchi-key=inchikey=hshnitrmyyllcv-uhfffaoysa-n}} |
| − | ** Category: [[annotation]]
| + | {{#set: molecular-weight=176.171}} |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ16180]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a | |
| − | * Gene: [[SJ21390]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a | |
| − | * Gene: [[SJ07211]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ17348]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ01444]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | </div>
| |
| − | == Pathway(s) == | |
| − | * [[PWY-6435]], 4-hydroxybenzoate biosynthesis III (plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6435 PWY-6435]
| |
| − | ** '''4''' reactions found over '''5''' reactions in the full pathway
| |
| − | == Reconstruction information ==
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | |
| − | == External links == | |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=3-hydroxyacyl-coa dehydrogenase}} | |
| − | {{#set: ec-number=ec-1.1.1.35}} | |
| − | {{#set: nb gene associated=8}} | |
| − | {{#set: nb pathway associated=1}}
| |
| − | {{#set: reconstruction category=annotation|orthology}}
| |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
| |
