Difference between revisions of "CPD-182"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5468 RXN-5468] == * direction: ** left-to-right * common-name: ** dolichyl-p-man:man7glcnac2-pp...")
 
(Created page with "Category:metabolite == Metabolite CPD-182 == * common-name: ** 4-methylumbelliferone * smiles: ** cc1(=cc(oc2(c=c(o)c=cc1=2))=o) * inchi-key: ** hshnitrmyyllcv-uhfffaoysa-...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5468 RXN-5468] ==
+
== Metabolite CPD-182 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** dolichyl-p-man:man7glcnac2-pp-dolichol α-1,6-mannosyltransferase
+
** 4-methylumbelliferone
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.4.1.260 ec-2.4.1.260]
+
** cc1(=cc(oc2(c=c(o)c=cc1=2))=o)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-171]][c] '''+''' 1 [[CPD-5166]][c] '''=>''' 1 [[CPD-5167]][c] '''+''' 1 [[DOLICHOLP]][c] '''+''' 1 [[PROTON]][c]
+
** hshnitrmyyllcv-uhfffaoysa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ11524]]
+
** 176.171
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* Gene: [[SJ11915]]
+
* [[3.1.1.56-RXN]]
−
** Category: [[orthology]]
+
* [[RXN-10769]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) of unknown directionality ==
−
* Gene: [[SJ11523]]
+
{{#set: common-name=4-methylumbelliferone}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=hshnitrmyyllcv-uhfffaoysa-n}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: molecular-weight=176.171}}
−
== Pathway(s) ==
 
−
* [[MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS]], protein N-glycosylation initial phase (eukaryotic): [http://metacyc.org/META/NEW-IMAGE?object=MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS]
 
−
** '''16''' reactions found over '''19''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R06260 R06260]
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=29538 29538]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=dolichyl-p-man:man7glcnac2-pp-dolichol α-1,6-mannosyltransferase}}
 
−
{{#set: ec-number=ec-2.4.1.260}}
 
−
{{#set: nb gene associated=3}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=orthology|annotation}}
 
−
{{#set: reconstruction tool=pathwaytools|pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-182

  • common-name:
    • 4-methylumbelliferone
  • smiles:
    • cc1(=cc(oc2(c=c(o)c=cc1=2))=o)
  • inchi-key:
    • hshnitrmyyllcv-uhfffaoysa-n
  • molecular-weight:
    • 176.171

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-182&oldid=138701"