Difference between revisions of "CPD-18238"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PHENYL-PYRUVATE == * common-name: ** keto-phenylpyruvate * smiles: ** c([o-])(=o)c(=o)cc1(=cc=cc=c1) * inchi-key: ** btnmpgbkdvtsjy-uhfff...") |
(Created page with "Category:metabolite == Metabolite Pyruvate-Dehydrogenase-Phosphoserine == * common-name: ** a [pyruvate dehydrogenase e1 α subunit]-l-serine phosphate == Reaction(s)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Pyruvate-Dehydrogenase-Phosphoserine == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [pyruvate dehydrogenase e1 α subunit]-l-serine phosphate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[3.1.3.43-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[2. | + | * [[2.7.11.2-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [pyruvate dehydrogenase e1 α subunit]-l-serine phosphate}} |
| − | |||
| − | |||
Revision as of 18:58, 14 January 2021
Contents
Metabolite Pyruvate-Dehydrogenase-Phosphoserine
- common-name:
- a [pyruvate dehydrogenase e1 α subunit]-l-serine phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [pyruvate dehydrogenase e1 α subunit]-l-serine phosphate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
