Difference between revisions of "CPD-18238"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-16825 == * common-name: ** (s)-equol 4'-sulfate * smiles: ** c1(c=c(c=c2(occ(cc=12)c3(c=cc(=cc=3)os([o-])(=o)=o)))o) * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite CPD-18238 == * common-name: ** carboxyphosphate * smiles: ** c(=o)([o-])op([o-])(=o)o * inchi-key: ** lqqcgegrinlhdp-uhfffaoysa-l * molec...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-18238 == |
* common-name: | * common-name: | ||
− | ** | + | ** carboxyphosphate |
* smiles: | * smiles: | ||
− | ** | + | ** c(=o)([o-])op([o-])(=o)o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** lqqcgegrinlhdp-uhfffaoysa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 139.989 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-16910]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-16909]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=carboxyphosphate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=lqqcgegrinlhdp-uhfffaoysa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=139.989}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-18238
- common-name:
- carboxyphosphate
- smiles:
- c(=o)([o-])op([o-])(=o)o
- inchi-key:
- lqqcgegrinlhdp-uhfffaoysa-l
- molecular-weight:
- 139.989