Difference between revisions of "CPD-1828"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DNA-containing-aPurinic-Sites == * common-name: ** an apurinic site within dna == Reaction(s) known to consume the compound == == Reactio...") |
(Created page with "Category:metabolite == Metabolite CPD-1828 == * common-name: ** gdp-α-d-mannuronate * smiles: ** c(op(=o)([o-])op(=o)([o-])oc1(oc(c(=o)[o-])c(o)c(o)c(o)1))c2(oc(c(o)...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-1828 == |
* common-name: | * common-name: | ||
− | ** | + | ** gdp-α-d-mannuronate |
+ | * smiles: | ||
+ | ** c(op(=o)([o-])op(=o)([o-])oc1(oc(c(=o)[o-])c(o)c(o)c(o)1))c2(oc(c(o)c(o)2)n4(c=nc3(c(=o)nc(n)=nc=34))) | ||
+ | * inchi-key: | ||
+ | ** dnbsdudynpjvcn-zxtxfpbhsa-k | ||
+ | * molecular-weight: | ||
+ | ** 616.305 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[ALGINATE-SYNTHASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[GDP-MANNOSE-6-DEHYDROGENASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=gdp-α-d-mannuronate}} |
+ | {{#set: inchi-key=inchikey=dnbsdudynpjvcn-zxtxfpbhsa-k}} | ||
+ | {{#set: molecular-weight=616.305}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-1828
- common-name:
- gdp-α-d-mannuronate
- smiles:
- c(op(=o)([o-])op(=o)([o-])oc1(oc(c(=o)[o-])c(o)c(o)c(o)1))c2(oc(c(o)c(o)2)n4(c=nc3(c(=o)nc(n)=nc=34)))
- inchi-key:
- dnbsdudynpjvcn-zxtxfpbhsa-k
- molecular-weight:
- 616.305