Difference between revisions of "CPD-1828"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-arginyl-L-aspartyl-Peptides == * common-name: ** an n-terminal l-arginiyl-l-aspartyl-[protein] == Reaction(s) known to consume the comp...") |
(Created page with "Category:metabolite == Metabolite CPD-10712 == * common-name: ** di-trans, poly-cis-polyprenyl diphosphate (c80) * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-10712 == |
* common-name: | * common-name: | ||
− | ** | + | ** di-trans, poly-cis-polyprenyl diphosphate (c80) |
+ | * smiles: | ||
+ | ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op([o-])(=o)[o-] | ||
+ | * inchi-key: | ||
+ | ** tunipipdjadhsr-hiqrjctmsa-k | ||
+ | * molecular-weight: | ||
+ | ** 1264.842 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-9969]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=di-trans, poly-cis-polyprenyl diphosphate (c80)}} |
+ | {{#set: inchi-key=inchikey=tunipipdjadhsr-hiqrjctmsa-k}} | ||
+ | {{#set: molecular-weight=1264.842}} |
Revision as of 15:25, 5 January 2021
Contents
Metabolite CPD-10712
- common-name:
- di-trans, poly-cis-polyprenyl diphosphate (c80)
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op([o-])(=o)[o-]
- inchi-key:
- tunipipdjadhsr-hiqrjctmsa-k
- molecular-weight:
- 1264.842