Difference between revisions of "CPD-1828"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10712 == * common-name: ** di-trans, poly-cis-polyprenyl diphosphate (c80) * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)...")
(Created page with "Category:metabolite == Metabolite CPD-14158 == * common-name: ** nebramycin 5' * smiles: ** c([n+])c1(c(cc(c(o1)oc2(c(c(c([n+])cc([n+])2)oc3(oc(c(c(c(o)3)[n+])o)coc(=o)n))...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-10712 ==
+
== Metabolite CPD-14158 ==
 
* common-name:
 
* common-name:
** di-trans, poly-cis-polyprenyl diphosphate (c80)
+
** nebramycin 5'
 
* smiles:
 
* smiles:
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op([o-])(=o)[o-]
+
** c([n+])c1(c(cc(c(o1)oc2(c(c(c([n+])cc([n+])2)oc3(oc(c(c(c(o)3)[n+])o)coc(=o)n))o))[n+])o)
 
* inchi-key:
 
* inchi-key:
** tunipipdjadhsr-hiqrjctmsa-k
+
** yppfejhohnpklt-pbsuhmdjsa-s
 
* molecular-weight:
 
* molecular-weight:
** 1264.842
+
** 515.583
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9969]]
+
* [[RXN-13168]]
 +
* [[RXN-15284]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=di-trans, poly-cis-polyprenyl diphosphate (c80)}}
+
{{#set: common-name=nebramycin 5'}}
{{#set: inchi-key=inchikey=tunipipdjadhsr-hiqrjctmsa-k}}
+
{{#set: inchi-key=inchikey=yppfejhohnpklt-pbsuhmdjsa-s}}
{{#set: molecular-weight=1264.842}}
+
{{#set: molecular-weight=515.583}}

Revision as of 13:07, 14 January 2021

Metabolite CPD-14158

  • common-name:
    • nebramycin 5'
  • smiles:
    • c([n+])c1(c(cc(c(o1)oc2(c(c(c([n+])cc([n+])2)oc3(oc(c(c(c(o)3)[n+])o)coc(=o)n))o))[n+])o)
  • inchi-key:
    • yppfejhohnpklt-pbsuhmdjsa-s
  • molecular-weight:
    • 515.583

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality