Difference between revisions of "CPD-1828"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14158 == * common-name: ** nebramycin 5' * smiles: ** c([n+])c1(c(cc(c(o1)oc2(c(c(c([n+])cc([n+])2)oc3(oc(c(c(c(o)3)[n+])o)coc(=o)n))...")
(Created page with "Category:metabolite == Metabolite DNA-containing-aPurinic-Sites == * common-name: ** an apurinic site within dna == Reaction(s) known to consume the compound == == Reactio...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14158 ==
+
== Metabolite DNA-containing-aPurinic-Sites ==
 
* common-name:
 
* common-name:
** nebramycin 5'
+
** an apurinic site within dna
* smiles:
 
** c([n+])c1(c(cc(c(o1)oc2(c(c(c([n+])cc([n+])2)oc3(oc(c(c(c(o)3)[n+])o)coc(=o)n))o))[n+])o)
 
* inchi-key:
 
** yppfejhohnpklt-pbsuhmdjsa-s
 
* molecular-weight:
 
** 515.583
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13168]]
+
* [[3.2.2.23-RXN]]
* [[RXN-15284]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=nebramycin 5'}}
+
{{#set: common-name=an apurinic site within dna}}
{{#set: inchi-key=inchikey=yppfejhohnpklt-pbsuhmdjsa-s}}
 
{{#set: molecular-weight=515.583}}
 

Revision as of 18:53, 14 January 2021

Metabolite DNA-containing-aPurinic-Sites

  • common-name:
    • an apurinic site within dna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality