|
|
| (7 intermediate revisions by 3 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:gene]] | + | [[Category:metabolite]] |
| − | == Gene SJ15690 == | + | == Metabolite CPD-18309 == |
| − | * transcription-direction: | + | * common-name: |
| − | ** negative | + | ** n-(r,r)-3-epoxysuccinamoyl-(s)-2,3-diaminopropanoyl-l-valine |
| − | * right-end-position: | + | * smiles: |
| − | ** 105614 | + | ** cc(c)c(c([o-])=o)nc(=o)c([n+])cnc(=o)c1(oc(c(=o)n)1) |
| − | * left-end-position: | + | * inchi-key: |
| − | ** 87887 | + | ** hcgfosjnuodeoh-rulnzfcnsa-n |
| − | * centisome-position: | + | * molecular-weight: |
| − | ** 30.019947 | + | ** 316.313 |
| − | == Organism(s) associated with this gene == | + | == Reaction(s) known to consume the compound == |
| − | * [[S.japonica_carotenoid_curated]]
| + | == Reaction(s) known to produce the compound == |
| − | == Reaction(s) associated == | + | * [[RXN-16991]] |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | == Reaction(s) of unknown directionality == |
| − | * [[ATCY]]
| + | {{#set: common-name=n-(r,r)-3-epoxysuccinamoyl-(s)-2,3-diaminopropanoyl-l-valine}} |
| − | ** Category: [[orthology]]
| + | {{#set: inchi-key=inchikey=hcgfosjnuodeoh-rulnzfcnsa-n}} |
| − | *** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| + | {{#set: molecular-weight=316.313}} |
| − | * [[AUPT]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[DATCY]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[DATUP]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[DCTCP]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[DCTUP]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[DGTCY]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[DGTUP]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[DTTGY]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[DTTUP]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[DUTCP]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[DUTUP]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[GTCY]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[GTUP]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[ITCY]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a | |
| − | * [[ITUP]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[URIDINEKIN-RXN]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[URKI-RXN]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[UTCY]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[UTUP]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | </div>
| |
| − | == Pathway(s) associated == | |
| − | * [[PWY-7193]]
| |
| − | ** '''2''' reactions found over '''3''' reactions in the full pathway
| |
| − | {{#set: transcription-direction=negative}} | |
| − | {{#set: right-end-position=105614}}
| |
| − | {{#set: left-end-position=87887}}
| |
| − | {{#set: centisome-position=30.019947 }} | |
| − | {{#set: organism associated=S.japonica_carotenoid_curated}} | |
| − | {{#set: nb reaction associated=20}}
| |
| − | {{#set: nb pathway associated=1}}
| |
