Difference between revisions of "CPD-18312"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ05600 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * ACCOAth ** Category: [...") |
(Created page with "Category:metabolite == Metabolite CPD-18312 == * common-name: ** n-3-fumaramoyl-l-2,3-diaminopropanoate * smiles: ** c([o-])(=o)c=cc(=o)ncc([n+])c(n)=o * inchi-key: ** ujv...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-18312 == |
− | + | * common-name: | |
− | * [ | + | ** n-3-fumaramoyl-l-2,3-diaminopropanoate |
− | == | + | * smiles: |
− | + | ** c([o-])(=o)c=cc(=o)ncc([n+])c(n)=o | |
− | * | + | * inchi-key: |
− | ** | + | ** ujvdeptvvyupmx-qphdtyrisa-n |
− | * | + | * molecular-weight: |
− | + | ** 201.182 | |
− | ** | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-16291]] |
− | * | + | * [[RXN-16292]] |
− | * | + | * [[RXN-16293]] |
− | {{#set: | + | == Reaction(s) known to produce the compound == |
− | {{#set: | + | == Reaction(s) of unknown directionality == |
+ | {{#set: common-name=n-3-fumaramoyl-l-2,3-diaminopropanoate}} | ||
+ | {{#set: inchi-key=inchikey=ujvdeptvvyupmx-qphdtyrisa-n}} | ||
+ | {{#set: molecular-weight=201.182}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-18312
- common-name:
- n-3-fumaramoyl-l-2,3-diaminopropanoate
- smiles:
- c([o-])(=o)c=cc(=o)ncc([n+])c(n)=o
- inchi-key:
- ujvdeptvvyupmx-qphdtyrisa-n
- molecular-weight:
- 201.182