Difference between revisions of "CPD-18312"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ21359 == * transcription-direction: ** positive * right-end-position: ** 154882 * left-end-position: ** 139468 * centisome-position: ** 71.81151...")
(Created page with "Category:metabolite == Metabolite CPD-18312 == * common-name: ** n-3-fumaramoyl-l-2,3-diaminopropanoate * smiles: ** c([o-])(=o)c=cc(=o)ncc([n+])c(n)=o * inchi-key: ** ujv...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ21359 ==
+
== Metabolite CPD-18312 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** n-3-fumaramoyl-l-2,3-diaminopropanoate
−
* right-end-position:
+
* smiles:
−
** 154882
+
** c([o-])(=o)c=cc(=o)ncc([n+])c(n)=o
−
* left-end-position:
+
* inchi-key:
−
** 139468
+
** ujvdeptvvyupmx-qphdtyrisa-n
−
* centisome-position:
+
* molecular-weight:
−
** 71.81151   
+
** 201.182
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-16291]]
−
== Reaction(s) associated ==
+
* [[RXN-16292]]
−
* [[DIAMINOPIMDECARB-RXN]]
+
* [[RXN-16293]]
−
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
** Category: [[orthology]]
+
{{#set: common-name=n-3-fumaramoyl-l-2,3-diaminopropanoate}}
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
{{#set: inchi-key=inchikey=ujvdeptvvyupmx-qphdtyrisa-n}}
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=201.182}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-2942]]
 
−
** '''6''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-5097]]
 
−
** '''7''' reactions found over '''7''' reactions in the full pathway
 
−
* [[DAPLYSINESYN-PWY]]
 
−
** '''7''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-2941]]
 
−
** '''6''' reactions found over '''9''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=154882}}
 
−
{{#set: left-end-position=139468}}
 
−
{{#set: centisome-position=71.81151    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=1}}
 
−
{{#set: nb pathway associated=4}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-18312

  • common-name:
    • n-3-fumaramoyl-l-2,3-diaminopropanoate
  • smiles:
    • c([o-])(=o)c=cc(=o)ncc([n+])c(n)=o
  • inchi-key:
    • ujvdeptvvyupmx-qphdtyrisa-n
  • molecular-weight:
    • 201.182

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-18312&oldid=137932"