Difference between revisions of "CPD-18312"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite HMP == * common-name: ** 4-amino-2-methyl-5-pyrimidinemethanol * smiles: ** cc1(n=c(c(=cn=1)co)n) * inchi-key: ** vutbelpredjddh-uhfffaoy...") |
(Created page with "Category:metabolite == Metabolite CPD-18312 == * common-name: ** n-3-fumaramoyl-l-2,3-diaminopropanoate * smiles: ** c([o-])(=o)c=cc(=o)ncc([n+])c(n)=o * inchi-key: ** ujv...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-18312 == |
* common-name: | * common-name: | ||
| − | ** | + | ** n-3-fumaramoyl-l-2,3-diaminopropanoate |
* smiles: | * smiles: | ||
| − | ** | + | ** c([o-])(=o)c=cc(=o)ncc([n+])c(n)=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ujvdeptvvyupmx-qphdtyrisa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 201.182 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-16291]] |
| + | * [[RXN-16292]] | ||
| + | * [[RXN-16293]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n-3-fumaramoyl-l-2,3-diaminopropanoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ujvdeptvvyupmx-qphdtyrisa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=201.182}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-18312
- common-name:
- n-3-fumaramoyl-l-2,3-diaminopropanoate
- smiles:
- c([o-])(=o)c=cc(=o)ncc([n+])c(n)=o
- inchi-key:
- ujvdeptvvyupmx-qphdtyrisa-n
- molecular-weight:
- 201.182
