Difference between revisions of "CPD-18312"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Non-Glucur-Glucuronoside-Acceptors == * common-name: ** a non-glucuronated glucosyluronate acceptor == Reaction(s) known to consume the c...") |
(Created page with "Category:metabolite == Metabolite CPD-18312 == * common-name: ** n-3-fumaramoyl-l-2,3-diaminopropanoate * smiles: ** c([o-])(=o)c=cc(=o)ncc([n+])c(n)=o * inchi-key: ** ujv...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-18312 == |
* common-name: | * common-name: | ||
− | ** | + | ** n-3-fumaramoyl-l-2,3-diaminopropanoate |
+ | * smiles: | ||
+ | ** c([o-])(=o)c=cc(=o)ncc([n+])c(n)=o | ||
+ | * inchi-key: | ||
+ | ** ujvdeptvvyupmx-qphdtyrisa-n | ||
+ | * molecular-weight: | ||
+ | ** 201.182 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-16291]] |
+ | * [[RXN-16292]] | ||
+ | * [[RXN-16293]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=n-3-fumaramoyl-l-2,3-diaminopropanoate}} |
+ | {{#set: inchi-key=inchikey=ujvdeptvvyupmx-qphdtyrisa-n}} | ||
+ | {{#set: molecular-weight=201.182}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-18312
- common-name:
- n-3-fumaramoyl-l-2,3-diaminopropanoate
- smiles:
- c([o-])(=o)c=cc(=o)ncc([n+])c(n)=o
- inchi-key:
- ujvdeptvvyupmx-qphdtyrisa-n
- molecular-weight:
- 201.182