Difference between revisions of "CPD-18346"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9038 == * common-name: ** precorrin-1 * smiles: ** cc3(c4(=cc5(=c(c(ccc([o-])=o)=c(cc1(=c(ccc([o-])=o)c(cc(=o)[o-])=c(n1)cc2(nc(=c(cc...")
(Created page with "Category:metabolite == Metabolite CPD-18346 == * common-name: ** cis-vaccenoyl-coa * smiles: ** ccccccc=ccccccccccc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)oc...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9038 ==
+
== Metabolite CPD-18346 ==
 
* common-name:
 
* common-name:
** precorrin-1
+
** cis-vaccenoyl-coa
 
* smiles:
 
* smiles:
** cc3(c4(=cc5(=c(c(ccc([o-])=o)=c(cc1(=c(ccc([o-])=o)c(cc(=o)[o-])=c(n1)cc2(nc(=c(cc([o-])=o)c=2ccc([o-])=o)cc(c3ccc(=o)[o-])=n4)))n5)cc([o-])=o)))(cc([o-])=o)
+
** ccccccc=ccccccccccc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
 
* inchi-key:
 
* inchi-key:
** cjlvuwulfkhgfb-nzcajupmsa-f
+
** hejoxxlscaqqgq-saiinbspsa-j
 
* molecular-weight:
 
* molecular-weight:
** 842.768
+
** 1027.953
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8675]]
+
* [[FACOAE18111Z]]
 +
* [[RXN-17010]]
 +
* [[RXN-17011]]
 +
* [[RXN-17784]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[UROPORIIIMETHYLTRANSA-RXN]]
+
* [[FACOAL18111Z]]
 +
* [[RXN0-7238]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=precorrin-1}}
+
{{#set: common-name=cis-vaccenoyl-coa}}
{{#set: inchi-key=inchikey=cjlvuwulfkhgfb-nzcajupmsa-f}}
+
{{#set: inchi-key=inchikey=hejoxxlscaqqgq-saiinbspsa-j}}
{{#set: molecular-weight=842.768}}
+
{{#set: molecular-weight=1027.953}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-18346

  • common-name:
    • cis-vaccenoyl-coa
  • smiles:
    • ccccccc=ccccccccccc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
  • inchi-key:
    • hejoxxlscaqqgq-saiinbspsa-j
  • molecular-weight:
    • 1027.953

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality