Difference between revisions of "CPD-18348"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-2181 == * common-name: ** 1-oleoyl-2-oleoyl-phosphatidylcholine * smiles: ** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop([o-...")
(Created page with "Category:metabolite == Metabolite CPD-18348 == * common-name: ** 1-cis-vaccenoylglycerol-3-phosphate * smiles: ** ccccccc=ccccccccccc(=o)occ(cop(=o)([o-])[o-])o * inchi-ke...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-2181 ==
+
== Metabolite CPD-18348 ==
 
* common-name:
 
* common-name:
** 1-oleoyl-2-oleoyl-phosphatidylcholine
+
** 1-cis-vaccenoylglycerol-3-phosphate
 
* smiles:
 
* smiles:
** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop([o-])(=o)occ[n+](c)(c)c)=o
+
** ccccccc=ccccccccccc(=o)occ(cop(=o)([o-])[o-])o
 
* inchi-key:
 
* inchi-key:
** snkawjbjqdlsff-nvkmucnasa-n
+
** lwsyatlsxcuntb-whxugtbjsa-l
 
* molecular-weight:
 
* molecular-weight:
** 786.123
+
** 434.509
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8320]]
+
* [[RXN-17009]]
* [[RXN-8327]]
+
* [[RXN-17011]]
 +
* [[RXN-17013]]
 +
* [[RXN-17015]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-17016]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-oleoyl-2-oleoyl-phosphatidylcholine}}
+
{{#set: common-name=1-cis-vaccenoylglycerol-3-phosphate}}
{{#set: inchi-key=inchikey=snkawjbjqdlsff-nvkmucnasa-n}}
+
{{#set: inchi-key=inchikey=lwsyatlsxcuntb-whxugtbjsa-l}}
{{#set: molecular-weight=786.123}}
+
{{#set: molecular-weight=434.509}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-18348

  • common-name:
    • 1-cis-vaccenoylglycerol-3-phosphate
  • smiles:
    • ccccccc=ccccccccccc(=o)occ(cop(=o)([o-])[o-])o
  • inchi-key:
    • lwsyatlsxcuntb-whxugtbjsa-l
  • molecular-weight:
    • 434.509

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality