Difference between revisions of "CPD-18350"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-474 == * common-name: ** (+)-taxifolin * smiles: ** c1(c=c(o)c(o)=cc=1c2(oc3(c=c([o-])c=c(o)c(c(=o)c(o)2)=3))) * inchi-key: ** cxqwrc...") |
(Created page with "Category:metabolite == Metabolite CPD-10806 == * common-name: ** 4-hydroxy-2-nonenal * smiles: ** cccccc(o)[ch]=cc=o * inchi-key: ** jvjfiqyahpmbbx-fnorwqnlsa-n * molecula...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-10806 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-hydroxy-2-nonenal |
* smiles: | * smiles: | ||
| − | ** | + | ** cccccc(o)[ch]=cc=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** jvjfiqyahpmbbx-fnorwqnlsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 156.224 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-13673]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-hydroxy-2-nonenal}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=jvjfiqyahpmbbx-fnorwqnlsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=156.224}} |
Revision as of 15:27, 5 January 2021
Contents
Metabolite CPD-10806
- common-name:
- 4-hydroxy-2-nonenal
- smiles:
- cccccc(o)[ch]=cc=o
- inchi-key:
- jvjfiqyahpmbbx-fnorwqnlsa-n
- molecular-weight:
- 156.224
