Difference between revisions of "CPD-18351"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8355 == * common-name: ** 1-18:1-2-lysophosphatidylethanolamine * smiles: ** ccccccccc=ccccccccc(occ(o)cop([o-])(=o)occ[n+])=o * inch...") |
(Created page with "Category:metabolite == Metabolite CPD-18351 == * common-name: ** 1-cis-vaccenoyl-2-palmitoleoyl phosphatidate * smiles: ** ccccccc=ccccccccccc(occ(oc(=o)cccccccc=ccccccc)c...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-18351 == |
* common-name: | * common-name: | ||
| − | ** 1- | + | ** 1-cis-vaccenoyl-2-palmitoleoyl phosphatidate |
* smiles: | * smiles: | ||
| − | ** | + | ** ccccccc=ccccccccccc(occ(oc(=o)cccccccc=ccccccc)cop([o-])(=o)[o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** glznxlkbzkjbcj-nafnzuqfsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 670.905 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-17009]] |
| − | * [[RXN- | + | * [[RXN-17013]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=1- | + | {{#set: common-name=1-cis-vaccenoyl-2-palmitoleoyl phosphatidate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=glznxlkbzkjbcj-nafnzuqfsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=670.905}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-18351
- common-name:
- 1-cis-vaccenoyl-2-palmitoleoyl phosphatidate
- smiles:
- ccccccc=ccccccccccc(occ(oc(=o)cccccccc=ccccccc)cop([o-])(=o)[o-])=o
- inchi-key:
- glznxlkbzkjbcj-nafnzuqfsa-l
- molecular-weight:
- 670.905
