Difference between revisions of "CPD-18351"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8355 == * common-name: ** 1-18:1-2-lysophosphatidylethanolamine * smiles: ** ccccccccc=ccccccccc(occ(o)cop([o-])(=o)occ[n+])=o * inch...") |
(Created page with "Category:metabolite == Metabolite NN-dimethyl-terminal-PPK == * common-name: ** an n terminal n,n-dimethyl-ppk-[protein] == Reaction(s) known to consume the compound == ==...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite NN-dimethyl-terminal-PPK == |
* common-name: | * common-name: | ||
| − | ** | + | ** an n terminal n,n-dimethyl-ppk-[protein] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-13226]] |
| − | * [[RXN- | + | * [[RXN-13228]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an n terminal n,n-dimethyl-ppk-[protein]}} |
| − | |||
| − | |||
Revision as of 18:54, 14 January 2021
Contents
Metabolite NN-dimethyl-terminal-PPK
- common-name:
- an n terminal n,n-dimethyl-ppk-[protein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an n terminal n,n-dimethyl-ppk-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
