Difference between revisions of "CPD-18380"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ALPHA-GLUCOSE-16-BISPHOSPHATE == * common-name: ** α-glucose 1,6-bisphosphate * smiles: ** c(op([o-])(=o)[o-])c1(oc(c(c(c1o)o)o)op(...")
(Created page with "Category:metabolite == Metabolite CPD-18380 == * common-name: ** 1-myristoyl-2-palmitoleoyl phosphatidate * smiles: ** ccccccc=ccccccccc(=o)oc(coc(ccccccccccccc)=o)cop([o-...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ALPHA-GLUCOSE-16-BISPHOSPHATE ==
+
== Metabolite CPD-18380 ==
 
* common-name:
 
* common-name:
** α-glucose 1,6-bisphosphate
+
** 1-myristoyl-2-palmitoleoyl phosphatidate
 
* smiles:
 
* smiles:
** c(op([o-])(=o)[o-])c1(oc(c(c(c1o)o)o)op(=o)([o-])[o-])
+
** ccccccc=ccccccccc(=o)oc(coc(ccccccccccccc)=o)cop([o-])(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** rwhozgraxywrnx-vfuothlcsa-j
+
** aldwdbnwditvid-xswvmqtgsa-l
 
* molecular-weight:
 
* molecular-weight:
** 336.085
+
** 616.814
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16998]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16997]]
+
* [[RXN-17019]]
 +
* [[RXN-17020]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=α-glucose 1,6-bisphosphate}}
+
{{#set: common-name=1-myristoyl-2-palmitoleoyl phosphatidate}}
{{#set: inchi-key=inchikey=rwhozgraxywrnx-vfuothlcsa-j}}
+
{{#set: inchi-key=inchikey=aldwdbnwditvid-xswvmqtgsa-l}}
{{#set: molecular-weight=336.085}}
+
{{#set: molecular-weight=616.814}}

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-18380

  • common-name:
    • 1-myristoyl-2-palmitoleoyl phosphatidate
  • smiles:
    • ccccccc=ccccccccc(=o)oc(coc(ccccccccccccc)=o)cop([o-])(=o)[o-]
  • inchi-key:
    • aldwdbnwditvid-xswvmqtgsa-l
  • molecular-weight:
    • 616.814

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality