Difference between revisions of "CPD-18390"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11524 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxohexanoyl)-coa * smiles: ** ccc=ccc1(c(ccc(=o)1)cccc(=o)cc(s...")
(Created page with "Category:metabolite == Metabolite CPD-18390 == * common-name: ** 1-palmitoyl-2-myristoyl phosphatidate * smiles: ** cccccccccccccccc(=o)occ(cop(=o)([o-])[o-])oc(cccccccccc...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11524 ==
+
== Metabolite CPD-18390 ==
 
* common-name:
 
* common-name:
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxohexanoyl)-coa
+
** 1-palmitoyl-2-myristoyl phosphatidate
 
* smiles:
 
* smiles:
** ccc=ccc1(c(ccc(=o)1)cccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
+
** cccccccccccccccc(=o)occ(cop(=o)([o-])[o-])oc(ccccccccccccc)=o
 
* inchi-key:
 
* inchi-key:
** adgirvmshggghu-azvxsvfwsa-j
+
** gloxzzhezykxnv-wjokgbtcsa-l
 
* molecular-weight:
 
* molecular-weight:
** 1025.85
+
** 618.83
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10700]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10702]]
+
* [[RXN-17023]]
 +
* [[RXN-17024]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxohexanoyl)-coa}}
+
{{#set: common-name=1-palmitoyl-2-myristoyl phosphatidate}}
{{#set: inchi-key=inchikey=adgirvmshggghu-azvxsvfwsa-j}}
+
{{#set: inchi-key=inchikey=gloxzzhezykxnv-wjokgbtcsa-l}}
{{#set: molecular-weight=1025.85}}
+
{{#set: molecular-weight=618.83}}

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-18390

  • common-name:
    • 1-palmitoyl-2-myristoyl phosphatidate
  • smiles:
    • cccccccccccccccc(=o)occ(cop(=o)([o-])[o-])oc(ccccccccccccc)=o
  • inchi-key:
    • gloxzzhezykxnv-wjokgbtcsa-l
  • molecular-weight:
    • 618.83

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality