Difference between revisions of "CPD-18437"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ11632 == * transcription-direction: ** positive * right-end-position: ** 434439 * left-end-position: ** 430492 * centisome-position: ** 55.235542...")
(Created page with "Category:metabolite == Metabolite N-SUCCINYLLL-2-6-DIAMINOPIMELATE == * common-name: ** n-succinyl-l,l-2,6-diaminopimelate * smiles: ** c(cc([n+])c(=o)[o-])cc(nc(ccc([o-])...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ11632 ==
+
== Metabolite N-SUCCINYLLL-2-6-DIAMINOPIMELATE ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** n-succinyl-l,l-2,6-diaminopimelate
−
* right-end-position:
+
* smiles:
−
** 434439
+
** c(cc([n+])c(=o)[o-])cc(nc(ccc([o-])=o)=o)c([o-])=o
−
* left-end-position:
+
* inchi-key:
−
** 430492
+
** glxuwzbupatpbr-bqbzgakwsa-l
−
* centisome-position:
+
* molecular-weight:
−
** 55.235542   
+
** 288.257
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[SUCCINYLDIAMINOPIMTRANS-RXN]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[PANTOTHENATE-KIN-RXN]]
+
* [[SUCCINYLDIAMINOPIMTRANS-RXN]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=n-succinyl-l,l-2,6-diaminopimelate}}
−
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=glxuwzbupatpbr-bqbzgakwsa-l}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=288.257}}
−
== Pathway(s) associated ==
 
−
* [[PWY-3961]]
 
−
** '''1''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PANTO-PWY]]
 
−
** '''4''' reactions found over '''4''' reactions in the full pathway
 
−
* [[COA-PWY-1]]
 
−
** '''2''' reactions found over '''1''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=434439}}
 
−
{{#set: left-end-position=430492}}
 
−
{{#set: centisome-position=55.235542    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=1}}
 
−
{{#set: nb pathway associated=3}}
 

Revision as of 20:33, 18 December 2020

Metabolite N-SUCCINYLLL-2-6-DIAMINOPIMELATE

  • common-name:
    • n-succinyl-l,l-2,6-diaminopimelate
  • smiles:
    • c(cc([n+])c(=o)[o-])cc(nc(ccc([o-])=o)=o)c([o-])=o
  • inchi-key:
    • glxuwzbupatpbr-bqbzgakwsa-l
  • molecular-weight:
    • 288.257

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-18437&oldid=46810"