Difference between revisions of "CPD-18437"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite N-SUCCINYLLL-2-6-DIAMINOPIMELATE == * common-name: ** n-succinyl-l,l-2,6-diaminopimelate * smiles: ** c(cc([n+])c(=o)[o-])cc(nc(ccc([o-])...")
(Created page with "Category:metabolite == Metabolite 1-Alkyl-2-acyl-glycerol == * common-name: ** a 2-acyl-1-alkyl-sn-glycerol == Reaction(s) known to consume the compound == * RXN-17731...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite N-SUCCINYLLL-2-6-DIAMINOPIMELATE ==
+
== Metabolite 1-Alkyl-2-acyl-glycerol ==
 
* common-name:
 
* common-name:
** n-succinyl-l,l-2,6-diaminopimelate
+
** a 2-acyl-1-alkyl-sn-glycerol
* smiles:
 
** c(cc([n+])c(=o)[o-])cc(nc(ccc([o-])=o)=o)c([o-])=o
 
* inchi-key:
 
** glxuwzbupatpbr-bqbzgakwsa-l
 
* molecular-weight:
 
** 288.257
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[SUCCINYLDIAMINOPIMTRANS-RXN]]
+
* [[RXN-17731]]
 +
* [[RXN-17733]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[SUCCINYLDIAMINOPIMTRANS-RXN]]
+
* [[RXN-17730]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-succinyl-l,l-2,6-diaminopimelate}}
+
{{#set: common-name=a 2-acyl-1-alkyl-sn-glycerol}}
{{#set: inchi-key=inchikey=glxuwzbupatpbr-bqbzgakwsa-l}}
 
{{#set: molecular-weight=288.257}}
 

Revision as of 14:56, 5 January 2021

Metabolite 1-Alkyl-2-acyl-glycerol

  • common-name:
    • a 2-acyl-1-alkyl-sn-glycerol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality