Difference between revisions of "CPD-18489"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite yW-58 == * common-name: ** 7-[(3s)-4-methoxy-(3-amino-3-carboxypropyl)]-wyosine37 in trnaphe == Reaction(s) known to consume the compound...")
(Created page with "Category:metabolite == Metabolite CPD-18489 == * common-name: ** (3r)-hydroxy-tetracosatetraenoyl-coa * smiles: ** cccccc=ccc=ccc=ccc=ccccccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite yW-58 ==
+
== Metabolite CPD-18489 ==
 
* common-name:
 
* common-name:
** 7-[(3s)-4-methoxy-(3-amino-3-carboxypropyl)]-wyosine37 in trnaphe
+
** (3r)-hydroxy-tetracosatetraenoyl-coa
 +
* smiles:
 +
** cccccc=ccc=ccc=ccc=ccccccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 +
* inchi-key:
 +
** dmysjgjjptxmaw-jjkiljmssa-j
 +
* molecular-weight:
 +
** 1122.065
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14520]]
+
* [[RXN-17110]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14528]]
+
* [[RXN-17109]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=7-[(3s)-4-methoxy-(3-amino-3-carboxypropyl)]-wyosine37 in trnaphe}}
+
{{#set: common-name=(3r)-hydroxy-tetracosatetraenoyl-coa}}
 +
{{#set: inchi-key=inchikey=dmysjgjjptxmaw-jjkiljmssa-j}}
 +
{{#set: molecular-weight=1122.065}}

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-18489

  • common-name:
    • (3r)-hydroxy-tetracosatetraenoyl-coa
  • smiles:
    • cccccc=ccc=ccc=ccc=ccccccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • dmysjgjjptxmaw-jjkiljmssa-j
  • molecular-weight:
    • 1122.065

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality