Difference between revisions of "CPD-18490"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-482 == * common-name: ** gibberellin a51 * smiles: ** c=c1(c3(cc4(c1)(c([ch]5(c2(c(=o)oc(cc(o)c2)([ch](cc3)4)5)(c)))c([o-])=o))) * in...")
(Created page with "Category:metabolite == Metabolite CPD-15244 == * common-name: ** 3-oxo-(5z)-tetradecenoyl-coa * smiles: ** ccccccccc=ccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-482 ==
+
== Metabolite CPD-15244 ==
 
* common-name:
 
* common-name:
** gibberellin a51
+
** 3-oxo-(5z)-tetradecenoyl-coa
 
* smiles:
 
* smiles:
** c=c1(c3(cc4(c1)(c([ch]5(c2(c(=o)oc(cc(o)c2)([ch](cc3)4)5)(c)))c([o-])=o)))
+
** ccccccccc=ccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** hhdwsdsmwjqura-gbnxxhsssa-m
+
** kadpwmjvuvwqnk-stfckwfxsa-j
 
* molecular-weight:
 
* molecular-weight:
** 331.388
+
** 985.829
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-14393]]
 +
* [[RXN-14394]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-171]]
+
* [[RXN-14393]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=gibberellin a51}}
+
{{#set: common-name=3-oxo-(5z)-tetradecenoyl-coa}}
{{#set: inchi-key=inchikey=hhdwsdsmwjqura-gbnxxhsssa-m}}
+
{{#set: inchi-key=inchikey=kadpwmjvuvwqnk-stfckwfxsa-j}}
{{#set: molecular-weight=331.388}}
+
{{#set: molecular-weight=985.829}}

Revision as of 08:30, 15 March 2021

Metabolite CPD-15244

  • common-name:
    • 3-oxo-(5z)-tetradecenoyl-coa
  • smiles:
    • ccccccccc=ccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • kadpwmjvuvwqnk-stfckwfxsa-j
  • molecular-weight:
    • 985.829

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality