Difference between revisions of "CPD-18490"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Dipeptides-With-Proline-Carboxy == * common-name: ** a dipeptide with proline at the c-terminal == Reaction(s) known to consume the compo...") |
(Created page with "Category:metabolite == Metabolite CPD-18490 == * common-name: ** (2e,9z,12z,15z,18z)-tetracosa-2,9,12,15,18-pentaenoyl-coa * smiles: ** cccccc=ccc=ccc=ccc=ccccccc=cc(sccnc...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-18490 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (2e,9z,12z,15z,18z)-tetracosa-2,9,12,15,18-pentaenoyl-coa |
| + | * smiles: | ||
| + | ** cccccc=ccc=ccc=ccc=ccccccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o | ||
| + | * inchi-key: | ||
| + | ** avrcofdawhwkmb-mnthwfihsa-j | ||
| + | * molecular-weight: | ||
| + | ** 1104.05 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-17110]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(2e,9z,12z,15z,18z)-tetracosa-2,9,12,15,18-pentaenoyl-coa}} |
| + | {{#set: inchi-key=inchikey=avrcofdawhwkmb-mnthwfihsa-j}} | ||
| + | {{#set: molecular-weight=1104.05}} | ||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-18490
- common-name:
- (2e,9z,12z,15z,18z)-tetracosa-2,9,12,15,18-pentaenoyl-coa
- smiles:
- cccccc=ccc=ccc=ccc=ccccccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
- inchi-key:
- avrcofdawhwkmb-mnthwfihsa-j
- molecular-weight:
- 1104.05
