Difference between revisions of "CPD-18491"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-3701 RXN-3701] == * direction: ** reversible * common-name: ** geranylgeranyltransferase * ec-n...")
(Created page with "Category:metabolite == Metabolite CPD-18491 == * common-name: ** (6z,9z,12z,15z,18z)-tetracosapentaenoyl-coa * smiles: ** cccccc=ccc=ccc=ccc=ccc=cccccc(sccnc(=o)ccnc(=o)c(...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-3701 RXN-3701] ==
+
== Metabolite CPD-18491 ==
* direction:
 
** reversible
 
 
* common-name:
 
* common-name:
** geranylgeranyltransferase
+
** (6z,9z,12z,15z,18z)-tetracosapentaenoyl-coa
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/2.5.1.60 ec-2.5.1.60]
+
** cccccc=ccc=ccc=ccc=ccc=cccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
** [http://enzyme.expasy.org/EC/2.5.1.59 ec-2.5.1.59]
+
* inchi-key:
== Reaction formula ==
+
** xzynvqdkyrhkfg-qojzhlsosa-j
* 1 [[GERANYLGERANYL-PP]][c] '''+''' 1 [[PROT-CYS]][c] '''<=>''' 1 [[PPI]][c] '''+''' 1 [[S-GERANYLGERANYL-PROTEIN]][c]
+
* molecular-weight:
== Gene(s) associated with this reaction  ==
+
** 1104.05
* Gene: [[SJ06255]]
+
== Reaction(s) known to consume the compound ==
** Category: [[annotation]]
+
* [[RXN-17113]]
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
* Gene: [[SJ00009]]
+
* [[RXN-17112]]
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: common-name=(6z,9z,12z,15z,18z)-tetracosapentaenoyl-coa}}
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=xzynvqdkyrhkfg-qojzhlsosa-j}}
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: molecular-weight=1104.05}}
* Gene: [[SJ04802]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
* Gene: [[SJ18424]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
== Pathway(s) ==
 
== Reconstruction information  ==
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
== External links  ==
 
{{#set: direction=reversible}}
 
{{#set: common-name=geranylgeranyltransferase}}
 
{{#set: ec-number=ec-2.5.1.60|ec-2.5.1.59}}
 
{{#set: nb gene associated=4}}
 
{{#set: nb pathway associated=0}}
 
{{#set: reconstruction category=orthology|annotation}}
 
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome|output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-18491

  • common-name:
    • (6z,9z,12z,15z,18z)-tetracosapentaenoyl-coa
  • smiles:
    • cccccc=ccc=ccc=ccc=ccc=cccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • xzynvqdkyrhkfg-qojzhlsosa-j
  • molecular-weight:
    • 1104.05

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality