Difference between revisions of "CPD-18492"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Guanine26-Guanine27-in-tRNAs == * common-name: ** a guanine26/guanine27 in trna == Reaction(s) known to consume the compound == * RXN-1...")
(Created page with "Category:metabolite == Metabolite CPD-18492 == * common-name: ** (2e,6z,9z,12z,15z,18z)-tetracosahexaenoyl-coa * smiles: ** cccccc=ccc=ccc=ccc=ccc=cccc=cc(sccnc(=o)ccnc(=o...")
 
(5 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Guanine26-Guanine27-in-tRNAs ==
+
== Metabolite CPD-18492 ==
 
* common-name:
 
* common-name:
** a guanine26/guanine27 in trna
+
** (2e,6z,9z,12z,15z,18z)-tetracosahexaenoyl-coa
 +
* smiles:
 +
** cccccc=ccc=ccc=ccc=ccc=cccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 +
* inchi-key:
 +
** uyokhwfeuajfmg-uiyhdvlfsa-j
 +
* molecular-weight:
 +
** 1102.034
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12378]]
+
* [[RXN-17114]]
* [[RXN-12382]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-17113]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a guanine26/guanine27 in trna}}
+
{{#set: common-name=(2e,6z,9z,12z,15z,18z)-tetracosahexaenoyl-coa}}
 +
{{#set: inchi-key=inchikey=uyokhwfeuajfmg-uiyhdvlfsa-j}}
 +
{{#set: molecular-weight=1102.034}}

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-18492

  • common-name:
    • (2e,6z,9z,12z,15z,18z)-tetracosahexaenoyl-coa
  • smiles:
    • cccccc=ccc=ccc=ccc=ccc=cccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • uyokhwfeuajfmg-uiyhdvlfsa-j
  • molecular-weight:
    • 1102.034

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality