Difference between revisions of "CPD-18494"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ00348 == * transcription-direction: ** positive * right-end-position: ** 62269 * left-end-position: ** 57108 * centisome-position: ** 33.94376...")
 
(Created page with "Category:metabolite == Metabolite CPD-18494 == * common-name: ** 3-oxo-(6z,9z,12z,15z,18z)-tetracosapentaenoyl-coa * smiles: ** cccccc=ccc=ccc=ccc=ccc=cccc(=o)cc(sccnc(=o)...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ00348 ==
+
== Metabolite CPD-18494 ==
* transcription-direction:
+
* common-name:
** positive
+
** 3-oxo-(6z,9z,12z,15z,18z)-tetracosapentaenoyl-coa
* right-end-position:
+
* smiles:
** 62269
+
** cccccc=ccc=ccc=ccc=ccc=cccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
* left-end-position:
+
* inchi-key:
** 57108
+
** uiagujimvqpsdp-qojzhlsosa-j
* centisome-position:
+
* molecular-weight:
** 33.94376   
+
** 1118.034
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-17116]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[GAPDHSYNEC-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=3-oxo-(6z,9z,12z,15z,18z)-tetracosapentaenoyl-coa}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=uiagujimvqpsdp-qojzhlsosa-j}}
* [[GAPOXNPHOSPHN-RXN]]
+
{{#set: molecular-weight=1118.034}}
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* [[RXN-15115]]
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
== Pathway(s) associated ==
 
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
* [[GLUCONEO-PWY]]
 
** '''12''' reactions found over '''13''' reactions in the full pathway
 
* [[P124-PWY]]
 
** '''12''' reactions found over '''15''' reactions in the full pathway
 
* [[P185-PWY]]
 
** '''11''' reactions found over '''12''' reactions in the full pathway
 
* [[P122-PWY]]
 
** '''16''' reactions found over '''18''' reactions in the full pathway
 
* [[PWY-5484]]
 
** '''10''' reactions found over '''11''' reactions in the full pathway
 
* [[PWY-1042]]
 
** '''9''' reactions found over '''10''' reactions in the full pathway
 
* [[GLYCOLYSIS]]
 
** '''11''' reactions found over '''12''' reactions in the full pathway
 
* [[ANAGLYCOLYSIS-PWY]]
 
** '''10''' reactions found over '''11''' reactions in the full pathway
 
* [[SUCSYN-PWY]]
 
** '''6''' reactions found over '''7''' reactions in the full pathway
 
* [[PWY66-399]]
 
** '''11''' reactions found over '''12''' reactions in the full pathway
 
* [[PWY-6901]]
 
** '''10''' reactions found over '''8''' reactions in the full pathway
 
* [[PWY-7003]]
 
** '''8''' reactions found over '''6''' reactions in the full pathway
 
</div>
 
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=62269}}
 
{{#set: left-end-position=57108}}
 
{{#set: centisome-position=33.94376    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=3}}
 
{{#set: nb pathway associated=12}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-18494

  • common-name:
    • 3-oxo-(6z,9z,12z,15z,18z)-tetracosapentaenoyl-coa
  • smiles:
    • cccccc=ccc=ccc=ccc=ccc=cccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • uiagujimvqpsdp-qojzhlsosa-j
  • molecular-weight:
    • 1118.034

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality