Difference between revisions of "CPD-18532"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 1-183-2-183-SN-GLYCEROL-PHOSPHOCHOLINE == * common-name: ** 1-α-linolenoyl-2-α-linolenoyl-phosphatidylcholine * smiles: ** cc...")
(Created page with "Category:metabolite == Metabolite CPD-6082 == * common-name: ** 3-aminopropanal * smiles: ** c(cc[n+])=o * inchi-key: ** pcxdjqzlddhmgx-uhfffaoysa-o * molecular-weight: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 1-183-2-183-SN-GLYCEROL-PHOSPHOCHOLINE ==
+
== Metabolite CPD-6082 ==
 
* common-name:
 
* common-name:
** 1-α-linolenoyl-2-α-linolenoyl-phosphatidylcholine
+
** 3-aminopropanal
 
* smiles:
 
* smiles:
** ccc=ccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccc=ccc=ccc)cop([o-])(=o)occ[n+](c)(c)c)=o
+
** c(cc[n+])=o
 
* inchi-key:
 
* inchi-key:
** xxkfqtjojzelmd-jicbsjgisa-n
+
** pcxdjqzlddhmgx-uhfffaoysa-o
 
* molecular-weight:
 
* molecular-weight:
** 778.06
+
** 74.102
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-6382]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8325]]
 
* [[RXN-8331]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-α-linolenoyl-2-α-linolenoyl-phosphatidylcholine}}
+
{{#set: common-name=3-aminopropanal}}
{{#set: inchi-key=inchikey=xxkfqtjojzelmd-jicbsjgisa-n}}
+
{{#set: inchi-key=inchikey=pcxdjqzlddhmgx-uhfffaoysa-o}}
{{#set: molecular-weight=778.06}}
+
{{#set: molecular-weight=74.102}}

Revision as of 11:13, 15 January 2021

Metabolite CPD-6082

  • common-name:
    • 3-aminopropanal
  • smiles:
    • c(cc[n+])=o
  • inchi-key:
    • pcxdjqzlddhmgx-uhfffaoysa-o
  • molecular-weight:
    • 74.102

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality