Difference between revisions of "CPD-18532"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-6082 == * common-name: ** 3-aminopropanal * smiles: ** c(cc[n+])=o * inchi-key: ** pcxdjqzlddhmgx-uhfffaoysa-o * molecular-weight: **...")
(Created page with "Category:metabolite == Metabolite CPD-18532 == * common-name: ** (r)-β-hydroxy-l-kynurenine * smiles: ** c([o-])(=o)c([n+])c(o)c(=o)c1(=c(n)c=cc=c1) * inchi-key: ** m...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-6082 ==
+
== Metabolite CPD-18532 ==
 
* common-name:
 
* common-name:
** 3-aminopropanal
+
** (r)-β-hydroxy-l-kynurenine
 
* smiles:
 
* smiles:
** c(cc[n+])=o
+
** c([o-])(=o)c([n+])c(o)c(=o)c1(=c(n)c=cc=c1)
 
* inchi-key:
 
* inchi-key:
** pcxdjqzlddhmgx-uhfffaoysa-o
+
** memllrtvgbiljw-ionnqarksa-n
 
* molecular-weight:
 
* molecular-weight:
** 74.102
+
** 224.216
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-6382]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-17150]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-aminopropanal}}
+
{{#set: common-name=(r)-β-hydroxy-l-kynurenine}}
{{#set: inchi-key=inchikey=pcxdjqzlddhmgx-uhfffaoysa-o}}
+
{{#set: inchi-key=inchikey=memllrtvgbiljw-ionnqarksa-n}}
{{#set: molecular-weight=74.102}}
+
{{#set: molecular-weight=224.216}}

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-18532

  • common-name:
    • (r)-β-hydroxy-l-kynurenine
  • smiles:
    • c([o-])(=o)c([n+])c(o)c(=o)c1(=c(n)c=cc=c1)
  • inchi-key:
    • memllrtvgbiljw-ionnqarksa-n
  • molecular-weight:
    • 224.216

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality