Difference between revisions of "CPD-18532"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ09109 == * transcription-direction: ** negative * right-end-position: ** 4934 * left-end-position: ** 544 * centisome-position: ** 1.2091844 ==...") |
(Created page with "Category:metabolite == Metabolite CPD-18532 == * common-name: ** (r)-β-hydroxy-l-kynurenine * smiles: ** c([o-])(=o)c([n+])c(o)c(=o)c1(=c(n)c=cc=c1) * inchi-key: ** m...") |
||
(9 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-18532 == |
− | * | + | * common-name: |
− | ** | + | ** (r)-β-hydroxy-l-kynurenine |
− | + | * smiles: | |
− | + | ** c([o-])(=o)c([n+])c(o)c(=o)c1(=c(n)c=cc=c1) | |
− | + | * inchi-key: | |
− | * | + | ** memllrtvgbiljw-ionnqarksa-n |
− | + | * molecular-weight: | |
− | ** | + | ** 224.216 |
− | + | == Reaction(s) known to consume the compound == | |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | * [[RXN-17150]] |
− | * | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=(r)-β-hydroxy-l-kynurenine}} | |
− | ** | + | {{#set: inchi-key=inchikey=memllrtvgbiljw-ionnqarksa-n}} |
− | + | {{#set: molecular-weight=224.216}} | |
− | |||
− | |||
− | * | ||
− | |||
− | ** | ||
− | == | ||
− | |||
− | |||
− | * [[ | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-18532
- common-name:
- (r)-β-hydroxy-l-kynurenine
- smiles:
- c([o-])(=o)c([n+])c(o)c(=o)c1(=c(n)c=cc=c1)
- inchi-key:
- memllrtvgbiljw-ionnqarksa-n
- molecular-weight:
- 224.216