Difference between revisions of "CPD-18532"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite HG+2 == * common-name: ** hg2+ * smiles: ** [hg++] * inchi-key: ** bqpiggfysbelgy-uhfffaoysa-n * molecular-weight: ** 200.59 == Reaction(...") |
(Created page with "Category:metabolite == Metabolite CPD-1103 == * common-name: ** taxiphyllin * smiles: ** c1(c=c(o)c=cc=1c(oc2(oc(co)c(o)c(o)c(o)2))c#n) * inchi-key: ** nvltyojhpbmilu-gmdx...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-1103 == |
* common-name: | * common-name: | ||
− | ** | + | ** taxiphyllin |
* smiles: | * smiles: | ||
− | ** | + | ** c1(c=c(o)c=cc=1c(oc2(oc(co)c(o)c(o)c(o)2))c#n) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** nvltyojhpbmilu-gmdxdwkasa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 311.291 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-13600]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=taxiphyllin}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=nvltyojhpbmilu-gmdxdwkasa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=311.291}} |
Revision as of 13:08, 14 January 2021
Contents
Metabolite CPD-1103
- common-name:
- taxiphyllin
- smiles:
- c1(c=c(o)c=cc=1c(oc2(oc(co)c(o)c(o)c(o)2))c#n)
- inchi-key:
- nvltyojhpbmilu-gmdxdwkasa-n
- molecular-weight:
- 311.291