Difference between revisions of "CPD-18550"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ09766 == * transcription-direction: ** negative * right-end-position: ** 34273 * left-end-position: ** 21817 * centisome-position: ** 58.71098...") |
(Created page with "Category:metabolite == Metabolite CPD-18550 == * common-name: ** quinoxaline-2-carboxyl adenylate * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(oc(=o)c4(c=...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-18550 == |
− | * | + | * common-name: |
− | ** | + | ** quinoxaline-2-carboxyl adenylate |
− | + | * smiles: | |
− | + | ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(oc(=o)c4(c=nc5(=cc=cc=c(n=4)5)))([o-])=o | |
− | * | + | * inchi-key: |
− | ** | + | ** vmjweicpcdrxql-scfuhwhpsa-m |
− | + | * molecular-weight: | |
− | + | ** 502.359 | |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-17155]] | |
− | == | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | * | + | {{#set: common-name=quinoxaline-2-carboxyl adenylate}} |
− | ** | + | {{#set: inchi-key=inchikey=vmjweicpcdrxql-scfuhwhpsa-m}} |
− | + | {{#set: molecular-weight=502.359}} | |
− | |||
− | |||
− | * | ||
− | |||
− | ** | ||
− | == | ||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-18550
- common-name:
- quinoxaline-2-carboxyl adenylate
- smiles:
- c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(oc(=o)c4(c=nc5(=cc=cc=c(n=4)5)))([o-])=o
- inchi-key:
- vmjweicpcdrxql-scfuhwhpsa-m
- molecular-weight:
- 502.359