Difference between revisions of "CPD-18550"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ09766 == * transcription-direction: ** negative * right-end-position: ** 34273 * left-end-position: ** 21817 * centisome-position: ** 58.71098...")
 
(Created page with "Category:metabolite == Metabolite CPD-18550 == * common-name: ** quinoxaline-2-carboxyl adenylate * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(oc(=o)c4(c=...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ09766 ==
+
== Metabolite CPD-18550 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** quinoxaline-2-carboxyl adenylate
−
* right-end-position:
+
* smiles:
−
** 34273
+
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(oc(=o)c4(c=nc5(=cc=cc=c(n=4)5)))([o-])=o
−
* left-end-position:
+
* inchi-key:
−
** 21817
+
** vmjweicpcdrxql-scfuhwhpsa-m
−
* centisome-position:
+
* molecular-weight:
−
** 58.71098   
+
** 502.359
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-17155]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[RXN-4021]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=quinoxaline-2-carboxyl adenylate}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=vmjweicpcdrxql-scfuhwhpsa-m}}
−
** Category: [[orthology]]
+
{{#set: molecular-weight=502.359}}
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN3O-178]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-2541]]
 
−
** '''11''' reactions found over '''35''' reactions in the full pathway
 
−
* [[PWY-7155]]
 
−
** '''4''' reactions found over '''6''' reactions in the full pathway
 
−
* [[PWY-6075]]
 
−
** '''3''' reactions found over '''5''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=34273}}
 
−
{{#set: left-end-position=21817}}
 
−
{{#set: centisome-position=58.71098    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=3}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-18550

  • common-name:
    • quinoxaline-2-carboxyl adenylate
  • smiles:
    • c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(oc(=o)c4(c=nc5(=cc=cc=c(n=4)5)))([o-])=o
  • inchi-key:
    • vmjweicpcdrxql-scfuhwhpsa-m
  • molecular-weight:
    • 502.359

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-18550&oldid=137636"