Difference between revisions of "CPD-18666"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18666 == * common-name: ** epoxypheophorbide a * smiles: ** ccc1(=c(c)c3(=nc1=cc6(=c(c)c7(c(=o)[c-](c(oc)=o)c(=c2(c(ccc(=o)[o-])c(c)c...")
(Created page with "Category:metabolite == Metabolite HYDROXY-METHYL-BUTENYL-DIP == * common-name: ** (e)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate * smiles: ** cc(co)=ccop(op([o-])(=o)[o-]...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-18666 ==
+
== Metabolite HYDROXY-METHYL-BUTENYL-DIP ==
 
* common-name:
 
* common-name:
** epoxypheophorbide a
+
** (e)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate
 
* smiles:
 
* smiles:
** ccc1(=c(c)c3(=nc1=cc6(=c(c)c7(c(=o)[c-](c(oc)=o)c(=c2(c(ccc(=o)[o-])c(c)c(=n2)c=c5(c(c)=c(c=c)c4(oc34)(n5))))c(n6)=7))))
+
** cc(co)=ccop(op([o-])(=o)[o-])(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** zmtpzdvbgynplz-ygowezgdsa-m
+
** mdsizrkjvdmqoq-gorduthdsa-k
 
* molecular-weight:
 
* molecular-weight:
** 606.677
+
** 259.069
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[HDS]]
 +
* [[IDS1]]
 +
* [[IDS2]]
 +
* [[ISPH2-RXN]]
 +
* [[RXN0-884]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17252]]
+
* [[HDS]]
 +
* [[RXN-15878]]
 +
* [[RXN0-882]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=epoxypheophorbide a}}
+
{{#set: common-name=(e)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate}}
{{#set: inchi-key=inchikey=zmtpzdvbgynplz-ygowezgdsa-m}}
+
{{#set: inchi-key=inchikey=mdsizrkjvdmqoq-gorduthdsa-k}}
{{#set: molecular-weight=606.677}}
+
{{#set: molecular-weight=259.069}}

Revision as of 11:16, 15 January 2021

Metabolite HYDROXY-METHYL-BUTENYL-DIP

  • common-name:
    • (e)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate
  • smiles:
    • cc(co)=ccop(op([o-])(=o)[o-])(=o)[o-]
  • inchi-key:
    • mdsizrkjvdmqoq-gorduthdsa-k
  • molecular-weight:
    • 259.069

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality