Difference between revisions of "CPD-18666"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-23713 == == Reaction(s) known to consume the compound == * RXN-21834 == Reaction(s) known to produce the compound == * RXN-2183...") |
(Created page with "Category:metabolite == Metabolite CPD-18666 == * common-name: ** epoxypheophorbide a * smiles: ** ccc1(=c(c)c3(=nc1=cc6(=c(c)c7(c(=o)[c-](c(oc)=o)c(=c2(c(ccc(=o)[o-])c(c)c...") |
||
| (3 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-18666 == |
| + | * common-name: | ||
| + | ** epoxypheophorbide a | ||
| + | * smiles: | ||
| + | ** ccc1(=c(c)c3(=nc1=cc6(=c(c)c7(c(=o)[c-](c(oc)=o)c(=c2(c(ccc(=o)[o-])c(c)c(=n2)c=c5(c(c)=c(c=c)c4(oc34)(n5))))c(n6)=7)))) | ||
| + | * inchi-key: | ||
| + | ** zmtpzdvbgynplz-ygowezgdsa-m | ||
| + | * molecular-weight: | ||
| + | ** 606.677 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-17252]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=epoxypheophorbide a}} | ||
| + | {{#set: inchi-key=inchikey=zmtpzdvbgynplz-ygowezgdsa-m}} | ||
| + | {{#set: molecular-weight=606.677}} | ||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-18666
- common-name:
- epoxypheophorbide a
- smiles:
- ccc1(=c(c)c3(=nc1=cc6(=c(c)c7(c(=o)[c-](c(oc)=o)c(=c2(c(ccc(=o)[o-])c(c)c(=n2)c=c5(c(c)=c(c=c)c4(oc34)(n5))))c(n6)=7))))
- inchi-key:
- zmtpzdvbgynplz-ygowezgdsa-m
- molecular-weight:
- 606.677
