Difference between revisions of "CPD-18666"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ12523 == * transcription-direction: ** negative * right-end-position: ** 317108 * left-end-position: ** 305453 * centisome-position: ** 85.384315...")
(Created page with "Category:metabolite == Metabolite CPD-13533 == * common-name: ** (3r)-3-hydroxypentanoyl-coa * smiles: ** ccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ12523 ==
+
== Metabolite CPD-13533 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** (3r)-3-hydroxypentanoyl-coa
−
* right-end-position:
+
* smiles:
−
** 317108
+
** ccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o)o
−
* left-end-position:
+
* inchi-key:
−
** 305453
+
** yygypcrwzmlsgk-orumcernsa-j
−
* centisome-position:
+
* molecular-weight:
−
** 85.384315   
+
** 863.619
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-12560]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) of unknown directionality ==
−
* [[ADENPRIBOSYLTRAN-RXN]]
+
{{#set: common-name=(3r)-3-hydroxypentanoyl-coa}}
−
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=yygypcrwzmlsgk-orumcernsa-j}}
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=863.619}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[APPRT]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
* [[GUANPRIBOSYLTRAN-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[HPRT]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
* [[HYPOXANPRIBOSYLTRAN-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[XPPRT]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7807]]
 
−
** '''2''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-6610]]
 
−
** '''2''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-7805]]
 
−
** '''2''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-6605]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
* [[P121-PWY]]
 
−
** '''2''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-6599]]
 
−
** '''2''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-6620]]
 
−
** '''2''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-6609]]
 
−
** '''4''' reactions found over '''4''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=317108}}
 
−
{{#set: left-end-position=305453}}
 
−
{{#set: centisome-position=85.384315    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=6}}
 
−
{{#set: nb pathway associated=8}}
 

Revision as of 20:34, 18 December 2020

Metabolite CPD-13533

  • common-name:
    • (3r)-3-hydroxypentanoyl-coa
  • smiles:
    • ccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o)o
  • inchi-key:
    • yygypcrwzmlsgk-orumcernsa-j
  • molecular-weight:
    • 863.619

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-18666&oldid=47129"