Difference between revisions of "CPD-18666"

Revision as of 15:28, 5 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-13533 ==
+== Metabolite HYDROXY-METHYL-BUTENYL-DIP ==
 * common-name:
-** (3r)-3-hydroxypentanoyl-coa
+** (e)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate
 * smiles:
-** ccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o)o
+** cc(co)=ccop(op([o-])(=o)[o-])(=o)[o-]
 * inchi-key:
-** yygypcrwzmlsgk-orumcernsa-j
+** mdsizrkjvdmqoq-gorduthdsa-k
 * molecular-weight:
-** 863.619
+** 259.069
 == Reaction(s) known to consume the compound ==
-* [[RXN-12560]]
+* [[HDS]]
+* [[IDS1]]
+* [[IDS2]]
+* [[ISPH2-RXN]]
+* [[RXN0-884]]
 == Reaction(s) known to produce the compound ==
+* [[HDS]]
+* [[RXN-15878]]
+* [[RXN0-882]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=(3r)-3-hydroxypentanoyl-coa}}
+{{#set: common-name=(e)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate}}
-{{#set: inchi-key=inchikey=yygypcrwzmlsgk-orumcernsa-j}}
+{{#set: inchi-key=inchikey=mdsizrkjvdmqoq-gorduthdsa-k}}
-{{#set: molecular-weight=863.619}}
+{{#set: molecular-weight=259.069}}