Difference between revisions of "CPD-18666"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite HYDROXY-METHYL-BUTENYL-DIP == * common-name: ** (e)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate * smiles: ** cc(co)=ccop(op([o-])(=o)[o-]...")
(Created page with "Category:metabolite == Metabolite CPD-23713 == == Reaction(s) known to consume the compound == * RXN-21834 == Reaction(s) known to produce the compound == * RXN-2183...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite HYDROXY-METHYL-BUTENYL-DIP ==
+
== Metabolite CPD-23713 ==
* common-name:
 
** (e)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate
 
* smiles:
 
** cc(co)=ccop(op([o-])(=o)[o-])(=o)[o-]
 
* inchi-key:
 
** mdsizrkjvdmqoq-gorduthdsa-k
 
* molecular-weight:
 
** 259.069
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[HDS]]
+
* [[RXN-21834]]
* [[IDS1]]
 
* [[IDS2]]
 
* [[ISPH2-RXN]]
 
* [[RXN0-884]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[HDS]]
+
* [[RXN-21833]]
* [[RXN-15878]]
 
* [[RXN0-882]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(e)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate}}
 
{{#set: inchi-key=inchikey=mdsizrkjvdmqoq-gorduthdsa-k}}
 
{{#set: molecular-weight=259.069}}
 

Revision as of 13:10, 14 January 2021

Metabolite CPD-23713

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality