Difference between revisions of "CPD-187"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 7-METHYLGUANOSINE-5-PHOSPHATE == * common-name: ** n7-methylguanosine 5'-phosphate * smiles: ** c[n+]1(=cn(c2(n=c(n)nc(=o)c1=2))c3(oc(cop...")
(Created page with "Category:metabolite == Metabolite Protein-Disulfides == * common-name: ** a protein disulfide == Reaction(s) known to consume the compound == * 1.6.4.4-RXN * HDS =...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 7-METHYLGUANOSINE-5-PHOSPHATE ==
+
== Metabolite Protein-Disulfides ==
 
* common-name:
 
* common-name:
** n7-methylguanosine 5'-phosphate
+
** a protein disulfide
* smiles:
 
** c[n+]1(=cn(c2(n=c(n)nc(=o)c1=2))c3(oc(cop(=o)([o-])[o-])c(o)c(o)3))
 
* inchi-key:
 
** aokqnzvjjxpuqa-kqynxxcusa-m
 
* molecular-weight:
 
** 376.242
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12826]]
+
* [[1.6.4.4-RXN]]
 +
* [[HDS]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12826]]
+
* [[1.11.1.15-RXN]]
 +
* [[1.6.4.4-RXN]]
 +
* [[HDS]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n7-methylguanosine 5'-phosphate}}
+
{{#set: common-name=a protein disulfide}}
{{#set: inchi-key=inchikey=aokqnzvjjxpuqa-kqynxxcusa-m}}
 
{{#set: molecular-weight=376.242}}
 

Revision as of 08:31, 15 March 2021

Metabolite Protein-Disulfides

  • common-name:
    • a protein disulfide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality