Difference between revisions of "CPD-187"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10814 == * common-name: ** glycyl-l-proline * smiles: ** c1(n(c(=o)c[n+])c(cc1)c(=o)[o-]) * inchi-key: ** kznqnbzmbzjqjo-yfkpbyrvsa-n...") |
(Created page with "Category:metabolite == Metabolite CPD-187 == * common-name: ** 4-hydroxy-4-methyl-2-oxoglutarate == Reaction(s) known to consume the compound == == Reaction(s) known to pr...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-187 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-hydroxy-4-methyl-2-oxoglutarate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[4.1.3.17-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-hydroxy-4-methyl-2-oxoglutarate}} |
| − | |||
| − | |||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-187
- common-name:
- 4-hydroxy-4-methyl-2-oxoglutarate
