Difference between revisions of "CPD-18761"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ20946 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 1.14.11.2-RXN ** Categ...") |
(Created page with "Category:metabolite == Metabolite CPD-18761 == * common-name: ** coniferyl alcohol radical * smiles: ** coc1(=cc(=ccco)c=cc(=o)1) * inchi-key: ** orajwsykrgvtdp-uhfffaoysa...") |
||
| (8 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-18761 == |
| − | == | + | * common-name: |
| − | * | + | ** coniferyl alcohol radical |
| − | == Reaction(s) | + | * smiles: |
| − | * [[ | + | ** coc1(=cc(=ccco)c=cc(=o)1) |
| − | * | + | * inchi-key: |
| − | + | ** orajwsykrgvtdp-uhfffaoysa-n | |
| − | == | + | * molecular-weight: |
| − | + | ** 179.195 | |
| − | + | == Reaction(s) known to consume the compound == | |
| − | {{#set: | + | == Reaction(s) known to produce the compound == |
| − | {{#set: | + | * [[RXN-17351]] |
| − | {{#set: | + | * [[RXN-17352]] |
| + | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=coniferyl alcohol radical}} | ||
| + | {{#set: inchi-key=inchikey=orajwsykrgvtdp-uhfffaoysa-n}} | ||
| + | {{#set: molecular-weight=179.195}} | ||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-18761
- common-name:
- coniferyl alcohol radical
- smiles:
- coc1(=cc(=ccco)c=cc(=o)1)
- inchi-key:
- orajwsykrgvtdp-uhfffaoysa-n
- molecular-weight:
- 179.195
