Difference between revisions of "CPD-18761"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11641 == * common-name: ** 4-methylumbelliferyl glucoside * smiles: ** cc3(c2(c=cc(oc1(oc(co)c(o)c(o)c(o)1))=cc=2oc(=o)c=3)) * inchi-...")
(Created page with "Category:metabolite == Metabolite L-IDONATE == * common-name: ** l-idonate * smiles: ** c(o)c(o)c(o)c(o)c(o)c(=o)[o-] * inchi-key: ** rghnjxzeokukbd-sknvomklsa-m * molecul...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11641 ==
+
== Metabolite L-IDONATE ==
 
* common-name:
 
* common-name:
** 4-methylumbelliferyl glucoside
+
** l-idonate
 
* smiles:
 
* smiles:
** cc3(c2(c=cc(oc1(oc(co)c(o)c(o)c(o)1))=cc=2oc(=o)c=3))
+
** c(o)c(o)c(o)c(o)c(o)c(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** yudptgpsbjvhcn-ymiltqatsa-n
+
** rghnjxzeokukbd-sknvomklsa-m
 
* molecular-weight:
 
* molecular-weight:
** 338.313
+
** 195.149
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10769]]
+
* [[RXN-12107]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-methylumbelliferyl glucoside}}
+
{{#set: common-name=l-idonate}}
{{#set: inchi-key=inchikey=yudptgpsbjvhcn-ymiltqatsa-n}}
+
{{#set: inchi-key=inchikey=rghnjxzeokukbd-sknvomklsa-m}}
{{#set: molecular-weight=338.313}}
+
{{#set: molecular-weight=195.149}}

Revision as of 13:08, 14 January 2021

Metabolite L-IDONATE

  • common-name:
    • l-idonate
  • smiles:
    • c(o)c(o)c(o)c(o)c(o)c(=o)[o-]
  • inchi-key:
    • rghnjxzeokukbd-sknvomklsa-m
  • molecular-weight:
    • 195.149

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality