Difference between revisions of "CPD-18762"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5-METHYL-THF == * common-name: ** 5-methyltetrahydrofolate mono-l-glutamate * smiles: ** cn2([ch](cnc1(=c(c(=o)nc(n)=n1)2))cnc3(c=cc(c(=o...")
(Created page with "Category:metabolite == Metabolite CPD-18762 == * common-name: ** 4-hydroxy-2-methyl-4-[(2e,6e)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]quinolin-3(4h)-one 1-oxide * smiles...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 5-METHYL-THF ==
+
== Metabolite CPD-18762 ==
 
* common-name:
 
* common-name:
** 5-methyltetrahydrofolate mono-l-glutamate
+
** 4-hydroxy-2-methyl-4-[(2e,6e)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]quinolin-3(4h)-one 1-oxide
 
* smiles:
 
* smiles:
** cn2([ch](cnc1(=c(c(=o)nc(n)=n1)2))cnc3(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=3))
+
** cc(c)=cccc(c)=cccc(c)=ccc2(o)(c(c1(c=cc=cc=1[n+](=c(c)2)[o-]))=o)
 
* inchi-key:
 
* inchi-key:
** znovtxrbgfnyrx-stqmwfeesa-l
+
** hzbjgdkeajeslm-yefhwucqsa-n
 
* molecular-weight:
 
* molecular-weight:
** 457.445
+
** 395.541
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[HOMOCYSMETB12-RXN-HOMO-CYS/5-METHYL-THF//MET/THF.31.]]
+
* [[RXN-17334]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.5.1.20-RXN-5-METHYL-THF/NAD//METHYLENE-THF/NADH/PROTON.44.]]
 
* [[MTHFO]]
 
* [[MTHFO_LPAREN_nadp_RPAREN_]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-methyltetrahydrofolate mono-l-glutamate}}
+
{{#set: common-name=4-hydroxy-2-methyl-4-[(2e,6e)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]quinolin-3(4h)-one 1-oxide}}
{{#set: inchi-key=inchikey=znovtxrbgfnyrx-stqmwfeesa-l}}
+
{{#set: inchi-key=inchikey=hzbjgdkeajeslm-yefhwucqsa-n}}
{{#set: molecular-weight=457.445}}
+
{{#set: molecular-weight=395.541}}

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-18762

  • common-name:
    • 4-hydroxy-2-methyl-4-[(2e,6e)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]quinolin-3(4h)-one 1-oxide
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=ccc2(o)(c(c1(c=cc=cc=1[n+](=c(c)2)[o-]))=o)
  • inchi-key:
    • hzbjgdkeajeslm-yefhwucqsa-n
  • molecular-weight:
    • 395.541

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "4-hydroxy-2-methyl-4-[(2e,6e)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]quinolin-3(4h)-one 1-oxide" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.