Difference between revisions of "CPD-18762"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-CYSTATHIONINE == * common-name: ** l-cystathionine * smiles: ** c(scc(c([o-])=o)[n+])cc([n+])c([o-])=o * inchi-key: ** ilrylpwnyfxemh-w...")
(Created page with "Category:metabolite == Metabolite 5-METHYL-THF == * common-name: ** 5-methyltetrahydrofolate mono-l-glutamate * smiles: ** cn2([ch](cnc1(=c(c(=o)nc(n)=n1)2))cnc3(c=cc(c(=o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite L-CYSTATHIONINE ==
+
== Metabolite 5-METHYL-THF ==
 
* common-name:
 
* common-name:
** l-cystathionine
+
** 5-methyltetrahydrofolate mono-l-glutamate
 
* smiles:
 
* smiles:
** c(scc(c([o-])=o)[n+])cc([n+])c([o-])=o
+
** cn2([ch](cnc1(=c(c(=o)nc(n)=n1)2))cnc3(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=3))
 
* inchi-key:
 
* inchi-key:
** ilrylpwnyfxemh-whfbiakzsa-n
+
** znovtxrbgfnyrx-stqmwfeesa-l
 
* molecular-weight:
 
* molecular-weight:
** 222.259
+
** 457.445
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[CYSTATHIONASE-RXN]]
+
* [[HOMOCYSMETB12-RXN-HOMO-CYS/5-METHYL-THF//MET/THF.31.]]
* [[CYSTATHIONINE-BETA-SYNTHASE-RXN]]
 
* [[O-SUCCHOMOSERLYASE-RXN]]
 
* [[RXN-14048]]
 
* [[RXN-15130]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[CYSPH-RXN]]
+
* [[1.5.1.20-RXN-5-METHYL-THF/NAD//METHYLENE-THF/NADH/PROTON.44.]]
* [[CYSTATHIONASE-RXN]]
+
* [[MTHFO]]
* [[CYSTATHIONINE-BETA-SYNTHASE-RXN]]
+
* [[MTHFO_LPAREN_nadp_RPAREN_]]
* [[O-SUCCHOMOSERLYASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-cystathionine}}
+
{{#set: common-name=5-methyltetrahydrofolate mono-l-glutamate}}
{{#set: inchi-key=inchikey=ilrylpwnyfxemh-whfbiakzsa-n}}
+
{{#set: inchi-key=inchikey=znovtxrbgfnyrx-stqmwfeesa-l}}
{{#set: molecular-weight=222.259}}
+
{{#set: molecular-weight=457.445}}

Revision as of 14:56, 5 January 2021

Metabolite 5-METHYL-THF

  • common-name:
    • 5-methyltetrahydrofolate mono-l-glutamate
  • smiles:
    • cn2([ch](cnc1(=c(c(=o)nc(n)=n1)2))cnc3(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=3))
  • inchi-key:
    • znovtxrbgfnyrx-stqmwfeesa-l
  • molecular-weight:
    • 457.445

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality