Difference between revisions of "CPD-18762"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ00577 == * transcription-direction: ** positive * right-end-position: ** 59171 * left-end-position: ** 36406 * centisome-position: ** 22.036196...")
(Created page with "Category:metabolite == Metabolite L-CYSTATHIONINE == * common-name: ** l-cystathionine * smiles: ** c(scc(c([o-])=o)[n+])cc([n+])c([o-])=o * inchi-key: ** ilrylpwnyfxemh-w...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ00577 ==
+
== Metabolite L-CYSTATHIONINE ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** l-cystathionine
−
* right-end-position:
+
* smiles:
−
** 59171
+
** c(scc(c([o-])=o)[n+])cc([n+])c([o-])=o
−
* left-end-position:
+
* inchi-key:
−
** 36406
+
** ilrylpwnyfxemh-whfbiakzsa-n
−
* centisome-position:
+
* molecular-weight:
−
** 22.036196   
+
** 222.259
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[CYSTATHIONASE-RXN]]
−
== Reaction(s) associated ==
+
* [[CYSTATHIONINE-BETA-SYNTHASE-RXN]]
−
* [[ATPASE-RXN]]
+
* [[O-SUCCHOMOSERLYASE-RXN]]
−
** Category: [[annotation]]
+
* [[RXN-14048]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-15130]]
−
** Category: [[orthology]]
+
== Reaction(s) known to produce the compound ==
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[CYSPH-RXN]]
−
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
+
* [[CYSTATHIONASE-RXN]]
−
** Category: [[annotation]]
+
* [[CYSTATHIONINE-BETA-SYNTHASE-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[O-SUCCHOMOSERLYASE-RXN]]
−
* [[RXN-12195]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=l-cystathionine}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=ilrylpwnyfxemh-whfbiakzsa-n}}
−
* [[RXN-12196]]
+
{{#set: molecular-weight=222.259}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN0-5462]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7210]]
 
−
** '''8''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-7198]]
 
−
** '''6''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-7184]]
 
−
** '''9''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-6545]]
 
−
** '''8''' reactions found over '''9''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=59171}}
 
−
{{#set: left-end-position=36406}}
 
−
{{#set: centisome-position=22.036196    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=5}}
 
−
{{#set: nb pathway associated=4}}
 

Revision as of 20:33, 18 December 2020

Metabolite L-CYSTATHIONINE

  • common-name:
    • l-cystathionine
  • smiles:
    • c(scc(c([o-])=o)[n+])cc([n+])c([o-])=o
  • inchi-key:
    • ilrylpwnyfxemh-whfbiakzsa-n
  • molecular-weight:
    • 222.259

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-18762&oldid=46794"