Difference between revisions of "CPD-18885"

Latest revision as of 11:15, 18 March 2021

smiles:
- cc=c5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)[o-])c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3=4)=cc5=6)))=cc8(=c(c)c(c(c)=o)=c(n78)c=9))))))
common-name:
- bacteriochlorophyllide b
molecular-weight:
- 628.966

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite L-CYSTEATE ==
+== Metabolite CPD-18885 ==
+* smiles:
+** cc=c5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)[o-])c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3=4)=cc5=6)))=cc8(=c(c)c(c(c)=o)=c(n78)c=9))))))
 * common-name:
-** l-cysteate
+** bacteriochlorophyllide b
-* smiles:
-** c(c([n+])c(=o)[o-])s(=o)(=o)[o-]
-* inchi-key:
-** xvoyscvbglvsol-reohclbhsa-m
 * molecular-weight:
-** 168.144
+** 628.966
 == Reaction(s) known to consume the compound ==
-* [[RXN-11737]]
+* [[RXN-17480]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-11737]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=l-cysteate}}
+{{#set: common-name=bacteriochlorophyllide b}}
-{{#set: inchi-key=inchikey=xvoyscvbglvsol-reohclbhsa-m}}
+{{#set: molecular-weight=628.966}}
-{{#set: molecular-weight=168.144}}