Difference between revisions of "CPD-18889"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Aryl-beta-D-Glucosides == * common-name: ** an aryl β-d-glucoside == Reaction(s) known to consume the compound == == Reaction(s) kno...") |
(Created page with "Category:metabolite == Metabolite CPD-15834 == * common-name: ** 2,3-dimethyl-6-geranylgeranyl-1,4-benzoquinol * smiles: ** cc(=cccc(c)=cccc(=cccc(c)=ccc1(=c(o)c(c)=c(c)c(...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-15834 == |
* common-name: | * common-name: | ||
− | ** | + | ** 2,3-dimethyl-6-geranylgeranyl-1,4-benzoquinol |
+ | * smiles: | ||
+ | ** cc(=cccc(c)=cccc(=cccc(c)=ccc1(=c(o)c(c)=c(c)c(o)=c1))c)c | ||
+ | * inchi-key: | ||
+ | ** qfmvwsptqocgtb-tuzvqdltsa-n | ||
+ | * molecular-weight: | ||
+ | ** 410.639 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-14917]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=2,3-dimethyl-6-geranylgeranyl-1,4-benzoquinol}} |
+ | {{#set: inchi-key=inchikey=qfmvwsptqocgtb-tuzvqdltsa-n}} | ||
+ | {{#set: molecular-weight=410.639}} |
Revision as of 14:54, 5 January 2021
Contents
Metabolite CPD-15834
- common-name:
- 2,3-dimethyl-6-geranylgeranyl-1,4-benzoquinol
- smiles:
- cc(=cccc(c)=cccc(=cccc(c)=ccc1(=c(o)c(c)=c(c)c(o)=c1))c)c
- inchi-key:
- qfmvwsptqocgtb-tuzvqdltsa-n
- molecular-weight:
- 410.639